C15H10ClN — CID 25035203
(4aZ,6E,10aZ,12Z)-6-chlorobenzo[c][1]benzazocine (PubChem CID 25035203) has the molecular formula C15H10ClN and a molecular weight of 239.71 g/mol. Its IUPAC name is (4aZ,6E,10aZ,12Z)-6-chlorobenzo[c][1]benzazocine.
| Compound Name | (4aZ,6E,10aZ,12Z)-6-chlorobenzo[c][1]benzazocine |
|---|---|
| PubChem CID | 25035203 |
| Molecular Formula | C15H10ClN |
| Molecular Weight | 239.71 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | (4aZ,6E,10aZ,12Z)-6-chlorobenzo[c][1]benzazocine |
| SMILES | ClC1=c2\cccc\c2=C\C=c2\cccc\c2=N\1 |
| InChI | InChI=1S/C15H10ClN/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)17-15/h1-10H/b10-9-,11-9-,12-10-,15-13-,17-14-,17-15+ |
| InChIKey | RJTAOPVOGUZUJI-GXYSKHEOSA-N |
| XLogP | 0.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.71 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|