C16H14N2 — CID 58612544
(6Z,10aZ)-6,11-dimethylbenzo[c][1,6]benzodiazocine (PubChem CID 58612544) has the molecular formula C16H14N2 and a molecular weight of 234.30 g/mol. Its IUPAC name is (6Z,10aZ)-6,11-dimethylbenzo[c][1,6]benzodiazocine.
| Compound Name | (6Z,10aZ)-6,11-dimethylbenzo[c][1,6]benzodiazocine |
|---|---|
| PubChem CID | 58612544 |
| Molecular Formula | C16H14N2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | (6Z,10aZ)-6,11-dimethylbenzo[c][1,6]benzodiazocine |
| SMILES | CC1=c2\cccc\c2=C(C)\N=c2\cccc\c2=N\1 |
| InChI | InChI=1S/C16H14N2/c1-11-13-7-3-4-8-14(13)12(2)18-16-10-6-5-9-15(16)17-11/h3-10H,1-2H3/b13-11-,14-12-,17-11-,17-15-,18-12-,18-16- |
| InChIKey | OELBDEMLNPEZBD-AEISYFOTSA-N |
| XLogP | 0.90 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |