C24H21N3 — CID 10689287
3,9,15-trimethyl-2,8,14-triazatetracyclo[14.2.2.24,7.210,13]tetracosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecaene (PubChem CID 10689287) has the molecular formula C24H21N3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 3,9,15-trimethyl-2,8,14-triazatetracyclo[14.2.2.24,7.210,13]tetracosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecaene.
| Compound Name | 3,9,15-trimethyl-2,8,14-triazatetracyclo[14.2.2.24,7.210,13]tetracosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecaene |
|---|---|
| PubChem CID | 10689287 |
| Molecular Formula | C24H21N3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 3,9,15-trimethyl-2,8,14-triazatetracyclo[14.2.2.24,7.210,13]tetracosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecaene |
| SMILES | Cc1nc2ccc(cc2)c(C)nc2ccc(cc2)c(C)nc2ccc1cc2 |
| InChI | InChI=1S/C24H21N3/c1-16-19-4-10-23(11-5-19)26-18(3)21-8-14-24(15-9-21)27-17(2)20-6-12-22(25-16)13-7-20/h4-15H,1-3H3/b19-16-,20-17-,21-18-,25-16-,25-22-,26-18-,26-23-,27-17-,27-24- |
| InChIKey | GNKMASQQJMNDSH-OGXCFAGWSA-N |
| XLogP | 5.94 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |