C21H38N2 — CID 153393623
(3E,5E)-3-N-butan-2-ylidene-2-N,4-dimethylhepta-3,5-diene-2,3-diimine;2-methylbuta-1,3-diene;propane (PubChem CID 153393623) has the molecular formula C21H38N2 and a molecular weight of 318.55 g/mol. Its IUPAC name is (3E,5E)-3-N-butan-2-ylidene-2-N,4-dimethylhepta-3,5-diene-2,3-diimine;2-methylbuta-1,3-diene;propane.
| Compound Name | (3E,5E)-3-N-butan-2-ylidene-2-N,4-dimethylhepta-3,5-diene-2,3-diimine;2-methylbuta-1,3-diene;propane |
|---|---|
| PubChem CID | 153393623 |
| Molecular Formula | C21H38N2 |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.30 |
| IUPAC Name | (3E,5E)-3-N-butan-2-ylidene-2-N,4-dimethylhepta-3,5-diene-2,3-diimine;2-methylbuta-1,3-diene;propane |
| SMILES | C/C=C/C(C)=C(/N=C(\C)CC)C(\C)=N\C.C=CC(=C)C.CCC |
| InChI | InChI=1S/C13H22N2.C5H8.C3H8/c1-7-9-10(3)13(12(5)14-6)15-11(4)8-2;1-4-5(2)3;1-3-2/h7,9H,8H2,1-6H3;4H,1-2H2,3H3;3H2,1-2H3/b9-7+,13-10+,14-12+,15-11+;; |
| InChIKey | RONSKMBTCAJDET-HKAFQYCISA-N |
| XLogP | 6.96 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|