C16H14N2 — CID 91867715
(6Z,12Z)-6,12-dimethylbenzo[c][1,5]benzodiazocine (PubChem CID 91867715) has the molecular formula C16H14N2 and a molecular weight of 234.30 g/mol. Its IUPAC name is (6Z,12Z)-6,12-dimethylbenzo[c][1,5]benzodiazocine.
| Compound Name | (6Z,12Z)-6,12-dimethylbenzo[c][1,5]benzodiazocine |
|---|---|
| PubChem CID | 91867715 |
| Molecular Formula | C16H14N2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | (6Z,12Z)-6,12-dimethylbenzo[c][1,5]benzodiazocine |
| SMILES | CC1=c2\cccc\c2=N\C(C)=c2\cccc\c2=N\1 |
| InChI | InChI=1S/C16H14N2/c1-11-13-7-3-5-9-15(13)18-12(2)14-8-4-6-10-16(14)17-11/h3-10H,1-2H3/b13-11-,14-12-,17-11-,17-16-,18-12-,18-15- |
| InChIKey | MHFIFVSFSAUREF-KCGSTWOVSA-N |
| XLogP | 0.90 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |