C13H19N — CID 142890522
(2E)-2-but-3-en-2-ylidene-6-methyl-3-methylidenepyridine;ethane (PubChem CID 142890522) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (2E)-2-but-3-en-2-ylidene-6-methyl-3-methylidenepyridine;ethane.
| Compound Name | (2E)-2-but-3-en-2-ylidene-6-methyl-3-methylidenepyridine;ethane |
|---|---|
| PubChem CID | 142890522 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (2E)-2-but-3-en-2-ylidene-6-methyl-3-methylidenepyridine;ethane |
| SMILES | C=C/C(C)=c1/nc(C)ccc1=C.CC |
| InChI | InChI=1S/C11H13N.C2H6/c1-5-8(2)11-9(3)6-7-10(4)12-11;1-2/h5-7H,1,3H2,2,4H3;1-2H3/b11-8+; |
| InChIKey | NGGZADVNURKFTP-YGCVIUNWSA-N |
| XLogP | 2.18 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |