C13H18F3N — CID 156649093
(3Z,5Z)-5-methyl-N-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)hepta-3,5-dien-2-imine (PubChem CID 156649093) has the molecular formula C13H18F3N and a molecular weight of 245.29 g/mol. Its IUPAC name is (3Z,5Z)-5-methyl-N-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)hepta-3,5-dien-2-imine.
| Compound Name | (3Z,5Z)-5-methyl-N-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)hepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 156649093 |
| Molecular Formula | C13H18F3N |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (3Z,5Z)-5-methyl-N-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)hepta-3,5-dien-2-imine |
| SMILES | C/C=C(C)\C=C/C(C)=N/C(=C(C)C)C(F)(F)F |
| InChI | InChI=1S/C13H18F3N/c1-6-10(4)7-8-11(5)17-12(9(2)3)13(14,15)16/h6-8H,1-5H3/b8-7-,10-6-,17-11+ |
| InChIKey | RSMBUINGJDTWMY-IMPCQJARSA-N |
| XLogP | 4.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|