About 1,4-benzodiazepin-4-amine;hydrochloride
1,4-benzodiazepin-4-amine;hydrochloride (PubChem CID 69060668) has the molecular formula C9H10ClN3
and a molecular weight of 195.65 g/mol. Its IUPAC name is 1,4-benzodiazepin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | 1,4-benzodiazepin-4-amine;hydrochloride |
| PubChem CID | 69060668 |
| Molecular Formula | C9H10ClN3 |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 1,4-benzodiazepin-4-amine;hydrochloride |
| SMILES | Cl.NN1C=CN=c2ccccc2=C1 |
| InChI | InChI=1S/C9H9N3.ClH/c10-12-6-5-11-9-4-2-1-3-8(9)7-12;/h1-7H,10H2;1H |
| InChIKey | OMDGDFCAZYZOQV-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 1,4-benzodiazepin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-benzodiazepin-4-amine;hydrochloride?
The IUPAC name of 1,4-benzodiazepin-4-amine;hydrochloride (CID 69060668) is 1,4-benzodiazepin-4-amine;hydrochloride.
What is the SMILES notation for 1,4-benzodiazepin-4-amine;hydrochloride?
The canonical SMILES for 1,4-benzodiazepin-4-amine;hydrochloride is Cl.NN1C=CN=c2ccccc2=C1.
What is the InChIKey of 1,4-benzodiazepin-4-amine;hydrochloride?
The InChIKey is OMDGDFCAZYZOQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3.ClH/c10-12-6-5-11-9-4-2-1-3-8(9)7-12;/h1-7H,10H2;1H.
What are the key properties of 1,4-benzodiazepin-4-amine;hydrochloride?
1,4-benzodiazepin-4-amine;hydrochloride has a molecular weight of 195.65 g/mol, XLogP of 0.13, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-benzodiazepin-4-amine;hydrochloride is sourced from PubChem (CID 69060668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).