C11H8N2O — CID 86206014
[1,3]oxazolo[3,2-d][1,4]benzodiazepine (PubChem CID 86206014) has the molecular formula C11H8N2O and a molecular weight of 184.20 g/mol. Its IUPAC name is [1,3]oxazolo[3,2-d][1,4]benzodiazepine.
| Compound Name | [1,3]oxazolo[3,2-d][1,4]benzodiazepine |
|---|---|
| PubChem CID | 86206014 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | [1,3]oxazolo[3,2-d][1,4]benzodiazepine |
| SMILES | C1=CN2C=COC2=c2ccccc2=N1 |
| InChI | InChI=1S/C11H8N2O/c1-2-4-10-9(3-1)11-13(6-5-12-10)7-8-14-11/h1-8H |
| InChIKey | IBDWEQVFNZSVFU-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |