C24H14Cl2 — CID 141495292
(4aZ,8aZ,12aZ,16aZ)-2,7-dichlorotetraphenylene (PubChem CID 141495292) has the molecular formula C24H14Cl2 and a molecular weight of 373.28 g/mol. Its IUPAC name is (4aZ,8aZ,12aZ,16aZ)-2,7-dichlorotetraphenylene.
| Compound Name | (4aZ,8aZ,12aZ,16aZ)-2,7-dichlorotetraphenylene |
|---|---|
| PubChem CID | 141495292 |
| Molecular Formula | C24H14Cl2 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | (4aZ,8aZ,12aZ,16aZ)-2,7-dichlorotetraphenylene |
| SMILES | Clc1ccc2/c(c1)=c1/cccc/c1=c1\cccc\c1=c1/cc(Cl)cc/c1=2 |
| InChI | InChI=1S/C24H14Cl2/c25-15-9-11-21-22-12-10-16(26)14-24(22)20-8-4-2-6-18(20)17-5-1-3-7-19(17)23(21)13-15/h1-14H/b18-17-,22-21-,23-19-,24-20- |
| InChIKey | JXCTWAWAXAOCNO-APHFGAQZSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |