C13H8N4 — CID 91583925
8,12,14,16-tetrazatetracyclo[9.5.1.02,7.014,17]heptadeca-1,3,5,7,9,11(17),12,15-octaene (PubChem CID 91583925) has the molecular formula C13H8N4 and a molecular weight of 220.24 g/mol. Its IUPAC name is 8,12,14,16-tetrazatetracyclo[9.5.1.02,7.014,17]heptadeca-1,3,5,7,9,11(17),12,15-octaene.
| Compound Name | 8,12,14,16-tetrazatetracyclo[9.5.1.02,7.014,17]heptadeca-1,3,5,7,9,11(17),12,15-octaene |
|---|---|
| PubChem CID | 91583925 |
| Molecular Formula | C13H8N4 |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 8,12,14,16-tetrazatetracyclo[9.5.1.02,7.014,17]heptadeca-1,3,5,7,9,11(17),12,15-octaene |
| SMILES | C1=Cc2ncn3cnc(c23)=c2cccc/c2=N/1 |
| InChI | InChI=1S/C13H8N4/c1-2-4-10-9(3-1)12-13-11(5-6-14-10)15-7-17(13)8-16-12/h1-8H/b6-5?,11-5?,12-9?,14-6?,14-10- |
| InChIKey | KDUAMGBFAIZSGQ-QFVCZJOISA-N |
| XLogP | 1.34 |
| TPSA | 42.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |