About 1-(4-imidazo[1,5-a]pyridin-1-ylphenyl)imidazo[1,5-a]pyridine
1-(4-imidazo[1,5-a]pyridin-1-ylphenyl)imidazo[1,5-a]pyridine (PubChem CID 4702100) has the molecular formula C20H14N4
and a molecular weight of 310.36 g/mol. Its IUPAC name is 1-(4-imidazo[1,5-a]pyridin-1-ylphenyl)imidazo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 1-(4-imidazo[1,5-a]pyridin-1-ylphenyl)imidazo[1,5-a]pyridine |
| PubChem CID | 4702100 |
| Molecular Formula | C20H14N4 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 1-(4-imidazo[1,5-a]pyridin-1-ylphenyl)imidazo[1,5-a]pyridine |
| SMILES | c1ccn2cnc(-c3ccc(-c4ncn5ccccc45)cc3)c2c1 |
| InChI | InChI=1S/C20H14N4/c1-3-11-23-13-21-19(17(23)5-1)15-7-9-16(10-8-15)20-18-6-2-4-12-24(18)14-22-20/h1-14H |
| InChIKey | UNPUBQACHLWPDI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 34.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-imidazo[1,5-a]pyridin-1-ylphenyl)imidazo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-imidazo[1,5-a]pyridin-1-ylphenyl)imidazo[1,5-a]pyridine?
The IUPAC name of 1-(4-imidazo[1,5-a]pyridin-1-ylphenyl)imidazo[1,5-a]pyridine (CID 4702100) is 1-(4-imidazo[1,5-a]pyridin-1-ylphenyl)imidazo[1,5-a]pyridine.
What is the SMILES notation for 1-(4-imidazo[1,5-a]pyridin-1-ylphenyl)imidazo[1,5-a]pyridine?
The canonical SMILES for 1-(4-imidazo[1,5-a]pyridin-1-ylphenyl)imidazo[1,5-a]pyridine is c1ccn2cnc(-c3ccc(-c4ncn5ccccc45)cc3)c2c1.
What is the InChIKey of 1-(4-imidazo[1,5-a]pyridin-1-ylphenyl)imidazo[1,5-a]pyridine?
The InChIKey is UNPUBQACHLWPDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N4/c1-3-11-23-13-21-19(17(23)5-1)15-7-9-16(10-8-15)20-18-6-2-4-12-24(18)14-22-20/h1-14H.
What are the key properties of 1-(4-imidazo[1,5-a]pyridin-1-ylphenyl)imidazo[1,5-a]pyridine?
1-(4-imidazo[1,5-a]pyridin-1-ylphenyl)imidazo[1,5-a]pyridine has a molecular weight of 310.36 g/mol, XLogP of 4.32, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-imidazo[1,5-a]pyridin-1-ylphenyl)imidazo[1,5-a]pyridine is sourced from PubChem (CID 4702100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).