C12H9N3 — CID 171925806
1-pyridin-4-ylimidazo[1,5-a]pyridine (PubChem CID 171925806) has the molecular formula C12H9N3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 1-pyridin-4-ylimidazo[1,5-a]pyridine.
| Compound Name | 1-pyridin-4-ylimidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 171925806 |
| Molecular Formula | C12H9N3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 1-pyridin-4-ylimidazo[1,5-a]pyridine |
| SMILES | c1ccn2cnc(-c3ccncc3)c2c1 |
| InChI | InChI=1S/C12H9N3/c1-2-8-15-9-14-12(11(15)3-1)10-4-6-13-7-5-10/h1-9H |
| InChIKey | AYBHIPFIEBASOI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |