About 1-phenylimidazo[1,5-a]pyridine;platinum
1-phenylimidazo[1,5-a]pyridine;platinum (PubChem CID 59171221) has the molecular formula C13H9N2Pt-
and a molecular weight of 388.31 g/mol. Its IUPAC name is 1-phenylimidazo[1,5-a]pyridine;platinum.
Molecular Properties
| Compound Name | 1-phenylimidazo[1,5-a]pyridine;platinum |
| PubChem CID | 59171221 |
| Molecular Formula | C13H9N2Pt- |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 1-phenylimidazo[1,5-a]pyridine;platinum |
| SMILES | [Pt].[c-]1ccccc1-c1ncn2ccccc12 |
| InChI | InChI=1S/C13H9N2.Pt/c1-2-6-11(7-3-1)13-12-8-4-5-9-15(12)10-14-13;/h1-6,8-10H;/q-1; |
| InChIKey | OGTYMTZYNMJQOM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylimidazo[1,5-a]pyridine;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylimidazo[1,5-a]pyridine;platinum?
The IUPAC name of 1-phenylimidazo[1,5-a]pyridine;platinum (CID 59171221) is 1-phenylimidazo[1,5-a]pyridine;platinum.
What is the SMILES notation for 1-phenylimidazo[1,5-a]pyridine;platinum?
The canonical SMILES for 1-phenylimidazo[1,5-a]pyridine;platinum is [Pt].[c-]1ccccc1-c1ncn2ccccc12.
What is the InChIKey of 1-phenylimidazo[1,5-a]pyridine;platinum?
The InChIKey is OGTYMTZYNMJQOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N2.Pt/c1-2-6-11(7-3-1)13-12-8-4-5-9-15(12)10-14-13;/h1-6,8-10H;/q-1;.
What are the key properties of 1-phenylimidazo[1,5-a]pyridine;platinum?
1-phenylimidazo[1,5-a]pyridine;platinum has a molecular weight of 388.31 g/mol, XLogP of 2.80, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylimidazo[1,5-a]pyridine;platinum is sourced from PubChem (CID 59171221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).