C16H9NO — CID 154129732
indeno[2,1-f]quinolin-1-one (PubChem CID 154129732) has the molecular formula C16H9NO and a molecular weight of 231.25 g/mol. Its IUPAC name is indeno[2,1-f]quinolin-1-one.
| Compound Name | indeno[2,1-f]quinolin-1-one |
|---|---|
| PubChem CID | 154129732 |
| Molecular Formula | C16H9NO |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | indeno[2,1-f]quinolin-1-one |
| SMILES | O=C1C=CN=c2ccc3c(c21)C=c1ccccc1=3 |
| InChI | InChI=1S/C16H9NO/c18-15-7-8-17-14-6-5-12-11-4-2-1-3-10(11)9-13(12)16(14)15/h1-9H |
| InChIKey | BTNXMPXEPZVWGX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |