About 2-phenylazete
2-phenylazete (PubChem CID 91343719) has the molecular formula C9H7N
and a molecular weight of 129.16 g/mol. Its IUPAC name is 2-phenylazete.
Molecular Properties
| Compound Name | 2-phenylazete |
| PubChem CID | 91343719 |
| Molecular Formula | C9H7N |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | 2-phenylazete |
| SMILES | C1=CC(c2ccccc2)=N1 |
| InChI | InChI=1S/C9H7N/c1-2-4-8(5-3-1)9-6-7-10-9/h1-7H |
| InChIKey | WYODVAZJZHZODW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-phenylazete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylazete?
The IUPAC name of 2-phenylazete (CID 91343719) is 2-phenylazete.
What is the SMILES notation for 2-phenylazete?
The canonical SMILES for 2-phenylazete is C1=CC(c2ccccc2)=N1.
What is the InChIKey of 2-phenylazete?
The InChIKey is WYODVAZJZHZODW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N/c1-2-4-8(5-3-1)9-6-7-10-9/h1-7H.
What are the key properties of 2-phenylazete?
2-phenylazete has a molecular weight of 129.16 g/mol, XLogP of 2.00, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylazete is sourced from PubChem (CID 91343719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).