About 2-phenylazocine;hydrobromide
2-phenylazocine;hydrobromide (PubChem CID 66675402) has the molecular formula C13H12BrN
and a molecular weight of 262.15 g/mol. Its IUPAC name is 2-phenylazocine;hydrobromide.
Molecular Properties
| Compound Name | 2-phenylazocine;hydrobromide |
| PubChem CID | 66675402 |
| Molecular Formula | C13H12BrN |
| Molecular Weight | 262.15 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 2-phenylazocine;hydrobromide |
| SMILES | Br.C1=CC=C/C(c2ccccc2)=N\C=C1 |
| InChI | InChI=1S/C13H11N.BrH/c1-2-7-11-14-13(10-6-1)12-8-4-3-5-9-12;/h1-11H;1H/b2-1?,6-1?,7-2?,10-6?,11-7?,13-10?,14-11?,14-13+; |
| InChIKey | KSVAPFIFIBJJMI-OLEUPMBJSA-N |
| XLogP | 3.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.15 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-phenylazocine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylazocine;hydrobromide?
The IUPAC name of 2-phenylazocine;hydrobromide (CID 66675402) is 2-phenylazocine;hydrobromide.
What is the SMILES notation for 2-phenylazocine;hydrobromide?
The canonical SMILES for 2-phenylazocine;hydrobromide is Br.C1=CC=C/C(c2ccccc2)=N\C=C1.
What is the InChIKey of 2-phenylazocine;hydrobromide?
The InChIKey is KSVAPFIFIBJJMI-OLEUPMBJSA-N. The full InChI is InChI=1S/C13H11N.BrH/c1-2-7-11-14-13(10-6-1)12-8-4-3-5-9-12;/h1-11H;1H/b2-1?,6-1?,7-2?,10-6?,11-7?,13-10?,14-11?,14-13+;.
What are the key properties of 2-phenylazocine;hydrobromide?
2-phenylazocine;hydrobromide has a molecular weight of 262.15 g/mol, XLogP of 3.69, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylazocine;hydrobromide is sourced from PubChem (CID 66675402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).