C14H8Cl2N2 — CID 15961548
(4aZ,6E,10aZ,12E)-6,12-dichlorobenzo[c][1,5]benzodiazocine (PubChem CID 15961548) has the molecular formula C14H8Cl2N2 and a molecular weight of 275.14 g/mol. Its IUPAC name is (4aZ,6E,10aZ,12E)-6,12-dichlorobenzo[c][1,5]benzodiazocine.
| Compound Name | (4aZ,6E,10aZ,12E)-6,12-dichlorobenzo[c][1,5]benzodiazocine |
|---|---|
| PubChem CID | 15961548 |
| Molecular Formula | C14H8Cl2N2 |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | (4aZ,6E,10aZ,12E)-6,12-dichlorobenzo[c][1,5]benzodiazocine |
| SMILES | ClC1=c2\cccc\c2=N\C(Cl)=c2\cccc\c2=N\1 |
| InChI | InChI=1S/C14H8Cl2N2/c15-13-9-5-1-3-7-11(9)17-14(16)10-6-2-4-8-12(10)18-13/h1-8H/b13-9-,14-10-,17-11-,17-14+,18-12-,18-13+ |
| InChIKey | DJQWGLFPWHESEO-ZHZWOCHRSA-N |
| XLogP | 1.25 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|