About copper;bis(3-(hydroxyamino)indol-2-one)
copper;bis(3-(hydroxyamino)indol-2-one) (PubChem CID 5473478) has the molecular formula C16H12CuN4O4
and a molecular weight of 387.84 g/mol. Its IUPAC name is copper;bis(3-(hydroxyamino)indol-2-one).
Molecular Properties
| Compound Name | copper;bis(3-(hydroxyamino)indol-2-one) |
| PubChem CID | 5473478 |
| Molecular Formula | C16H12CuN4O4 |
| Molecular Weight | 387.84 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | copper;bis(3-(hydroxyamino)indol-2-one) |
| SMILES | O=C1N=c2ccccc2=C1NO.O=C1N=c2ccccc2=C1NO.[Cu] |
| InChI | InChI=1S/2C8H6N2O2.Cu/c2*11-8-7(10-12)5-3-1-2-4-6(5)9-8;/h2*1-4,12H,(H,9,10,11); |
| InChIKey | LOUWIRBANPFKRJ-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.84 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze copper;bis(3-(hydroxyamino)indol-2-one) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;bis(3-(hydroxyamino)indol-2-one)?
The IUPAC name of copper;bis(3-(hydroxyamino)indol-2-one) (CID 5473478) is copper;bis(3-(hydroxyamino)indol-2-one).
What is the SMILES notation for copper;bis(3-(hydroxyamino)indol-2-one)?
The canonical SMILES for copper;bis(3-(hydroxyamino)indol-2-one) is O=C1N=c2ccccc2=C1NO.O=C1N=c2ccccc2=C1NO.[Cu].
What is the InChIKey of copper;bis(3-(hydroxyamino)indol-2-one)?
The InChIKey is LOUWIRBANPFKRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H6N2O2.Cu/c2*11-8-7(10-12)5-3-1-2-4-6(5)9-8;/h2*1-4,12H,(H,9,10,11);.
What are the key properties of copper;bis(3-(hydroxyamino)indol-2-one)?
copper;bis(3-(hydroxyamino)indol-2-one) has a molecular weight of 387.84 g/mol, XLogP of -2.14, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for copper;bis(3-(hydroxyamino)indol-2-one) is sourced from PubChem (CID 5473478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).