C16H14N2O — CID 154295670
3-(2,3,3a,4-tetrahydroindol-1-yl)indol-2-one (PubChem CID 154295670) has the molecular formula C16H14N2O and a molecular weight of 250.30 g/mol. Its IUPAC name is 3-(2,3,3a,4-tetrahydroindol-1-yl)indol-2-one.
| Compound Name | 3-(2,3,3a,4-tetrahydroindol-1-yl)indol-2-one |
|---|---|
| PubChem CID | 154295670 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 3-(2,3,3a,4-tetrahydroindol-1-yl)indol-2-one |
| SMILES | O=C1N=c2ccccc2=C1N1CCC2CC=CC=C21 |
| InChI | InChI=1S/C16H14N2O/c19-16-15(12-6-2-3-7-13(12)17-16)18-10-9-11-5-1-4-8-14(11)18/h1-4,6-8,11H,5,9-10H2 |
| InChIKey | NFRJKDDUNBCMLI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |