C13H19N5 — CID 175824479
3-(2-piperazin-1-ylethyl)-2H-1,2,3-benzotriazine (PubChem CID 175824479) has the molecular formula C13H19N5 and a molecular weight of 245.33 g/mol. Its IUPAC name is 3-(2-piperazin-1-ylethyl)-2H-1,2,3-benzotriazine.
| Compound Name | 3-(2-piperazin-1-ylethyl)-2H-1,2,3-benzotriazine |
|---|---|
| PubChem CID | 175824479 |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 3-(2-piperazin-1-ylethyl)-2H-1,2,3-benzotriazine |
| SMILES | C1=c2ccccc2=NNN1CCN1CCNCC1 |
| InChI | InChI=1S/C13H19N5/c1-2-4-13-12(3-1)11-18(16-15-13)10-9-17-7-5-14-6-8-17/h1-4,11,14,16H,5-10H2 |
| InChIKey | GDBORGIEUXEUHA-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |