About 3-(1-phenylethyl)azete
3-(1-phenylethyl)azete (PubChem CID 54172101) has the molecular formula C11H11N
and a molecular weight of 157.22 g/mol. Its IUPAC name is 3-(1-phenylethyl)azete.
Molecular Properties
| Compound Name | 3-(1-phenylethyl)azete |
| PubChem CID | 54172101 |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 3-(1-phenylethyl)azete |
| SMILES | CC(C1=CN=C1)c1ccccc1 |
| InChI | InChI=1S/C11H11N/c1-9(11-7-12-8-11)10-5-3-2-4-6-10/h2-9H,1H3 |
| InChIKey | OVSUEQONODKUBE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(1-phenylethyl)azete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-phenylethyl)azete?
The IUPAC name of 3-(1-phenylethyl)azete (CID 54172101) is 3-(1-phenylethyl)azete.
What is the SMILES notation for 3-(1-phenylethyl)azete?
The canonical SMILES for 3-(1-phenylethyl)azete is CC(C1=CN=C1)c1ccccc1.
What is the InChIKey of 3-(1-phenylethyl)azete?
The InChIKey is OVSUEQONODKUBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N/c1-9(11-7-12-8-11)10-5-3-2-4-6-10/h2-9H,1H3.
What are the key properties of 3-(1-phenylethyl)azete?
3-(1-phenylethyl)azete has a molecular weight of 157.22 g/mol, XLogP of 2.76, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-phenylethyl)azete is sourced from PubChem (CID 54172101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).