About 4-propan-2-yl-2,3-benzodithiine
4-propan-2-yl-2,3-benzodithiine (PubChem CID 169267016) has the molecular formula C11H12S2
and a molecular weight of 208.35 g/mol. Its IUPAC name is 4-propan-2-yl-2,3-benzodithiine.
Molecular Properties
| Compound Name | 4-propan-2-yl-2,3-benzodithiine |
| PubChem CID | 169267016 |
| Molecular Formula | C11H12S2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 4-propan-2-yl-2,3-benzodithiine |
| SMILES | CC(C)C1=c2ccccc2=CSS1 |
| InChI | InChI=1S/C11H12S2/c1-8(2)11-10-6-4-3-5-9(10)7-12-13-11/h3-8H,1-2H3 |
| InChIKey | KIBZXPKQHMERDA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 4-propan-2-yl-2,3-benzodithiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-2,3-benzodithiine?
The IUPAC name of 4-propan-2-yl-2,3-benzodithiine (CID 169267016) is 4-propan-2-yl-2,3-benzodithiine.
What is the SMILES notation for 4-propan-2-yl-2,3-benzodithiine?
The canonical SMILES for 4-propan-2-yl-2,3-benzodithiine is CC(C)C1=c2ccccc2=CSS1.
What is the InChIKey of 4-propan-2-yl-2,3-benzodithiine?
The InChIKey is KIBZXPKQHMERDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12S2/c1-8(2)11-10-6-4-3-5-9(10)7-12-13-11/h3-8H,1-2H3.
What are the key properties of 4-propan-2-yl-2,3-benzodithiine?
4-propan-2-yl-2,3-benzodithiine has a molecular weight of 208.35 g/mol, XLogP of 2.58, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-2,3-benzodithiine is sourced from PubChem (CID 169267016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).