About 5-methyl-2-benzothiepine
5-methyl-2-benzothiepine (PubChem CID 171650896) has the molecular formula C11H10S
and a molecular weight of 174.27 g/mol. Its IUPAC name is 5-methyl-2-benzothiepine.
Molecular Properties
| Compound Name | 5-methyl-2-benzothiepine |
| PubChem CID | 171650896 |
| Molecular Formula | C11H10S |
| Molecular Weight | 174.27 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 5-methyl-2-benzothiepine |
| SMILES | CC1=c2ccccc2=CSC=C1 |
| InChI | InChI=1S/C11H10S/c1-9-6-7-12-8-10-4-2-3-5-11(9)10/h2-8H,1H3 |
| InChIKey | SQUZPBRFKGYHTE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-methyl-2-benzothiepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-benzothiepine?
The IUPAC name of 5-methyl-2-benzothiepine (CID 171650896) is 5-methyl-2-benzothiepine.
What is the SMILES notation for 5-methyl-2-benzothiepine?
The canonical SMILES for 5-methyl-2-benzothiepine is CC1=c2ccccc2=CSC=C1.
What is the InChIKey of 5-methyl-2-benzothiepine?
The InChIKey is SQUZPBRFKGYHTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10S/c1-9-6-7-12-8-10-4-2-3-5-11(9)10/h2-8H,1H3.
What are the key properties of 5-methyl-2-benzothiepine?
5-methyl-2-benzothiepine has a molecular weight of 174.27 g/mol, XLogP of 1.86, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-benzothiepine is sourced from PubChem (CID 171650896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).