C19H23NO4 — CID 121260818
2-[2,5-bis(methoxymethoxy)phenyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 121260818) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-[2,5-bis(methoxymethoxy)phenyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-[2,5-bis(methoxymethoxy)phenyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 121260818 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 2-[2,5-bis(methoxymethoxy)phenyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | COCOc1ccc(OCOC)c(N2CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C19H23NO4/c1-21-13-23-17-7-8-19(24-14-22-2)18(11-17)20-10-9-15-5-3-4-6-16(15)12-20/h3-8,11H,9-10,12-14H2,1-2H3 |
| InChIKey | IMSLLNSXVIPZQH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|