C16H14N4 — CID 121265553
N-(pyridin-4-ylmethyl)-4H-imidazo[1,5-a]indol-4-amine (PubChem CID 121265553) has the molecular formula C16H14N4 and a molecular weight of 262.32 g/mol. Its IUPAC name is N-(pyridin-4-ylmethyl)-4H-imidazo[1,5-a]indol-4-amine.
| Compound Name | N-(pyridin-4-ylmethyl)-4H-imidazo[1,5-a]indol-4-amine |
|---|---|
| PubChem CID | 121265553 |
| Molecular Formula | C16H14N4 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | N-(pyridin-4-ylmethyl)-4H-imidazo[1,5-a]indol-4-amine |
| SMILES | c1ccc2c(c1)C(NCc1ccncc1)c1cncn1-2 |
| InChI | InChI=1S/C16H14N4/c1-2-4-14-13(3-1)16(15-10-18-11-20(14)15)19-9-12-5-7-17-8-6-12/h1-8,10-11,16,19H,9H2 |
| InChIKey | XUZJHFQLNKCHFN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |