C16H14N4 — CID 121265680
2-N-(4H-imidazo[1,5-a]indol-4-yl)benzene-1,2-diamine (PubChem CID 121265680) has the molecular formula C16H14N4 and a molecular weight of 262.32 g/mol. Its IUPAC name is 2-N-(4H-imidazo[1,5-a]indol-4-yl)benzene-1,2-diamine.
| Compound Name | 2-N-(4H-imidazo[1,5-a]indol-4-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 121265680 |
| Molecular Formula | C16H14N4 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2-N-(4H-imidazo[1,5-a]indol-4-yl)benzene-1,2-diamine |
| SMILES | Nc1ccccc1NC1c2ccccc2-n2cncc21 |
| InChI | InChI=1S/C16H14N4/c17-12-6-2-3-7-13(12)19-16-11-5-1-4-8-14(11)20-10-18-9-15(16)20/h1-10,16,19H,17H2 |
| InChIKey | YHHQYXWBKLUCON-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|