C16H11IN2 — CID 138482135
13-iodo-2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,5,7,9,11,14,16-octaene (PubChem CID 138482135) has the molecular formula C16H11IN2 and a molecular weight of 358.18 g/mol. Its IUPAC name is 13-iodo-2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,5,7,9,11,14,16-octaene.
| Compound Name | 13-iodo-2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,5,7,9,11,14,16-octaene |
|---|---|
| PubChem CID | 138482135 |
| Molecular Formula | C16H11IN2 |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | 13-iodo-2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,5,7,9,11,14,16-octaene |
| SMILES | IC1c2ccccc2-c2cncn2-c2ccccc21 |
| InChI | InChI=1S/C16H11IN2/c17-16-12-6-2-1-5-11(12)15-9-18-10-19(15)14-8-4-3-7-13(14)16/h1-10,16H |
| InChIKey | IEWHBKGGQSQYPL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|