C22H24N2O2 — CID 121267272
(4R,4aR,7aR,12bS)-3-(cyclobutylmethyl)-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-13-carbonitrile (PubChem CID 121267272) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is (4R,4aR,7aR,12bS)-3-(cyclobutylmethyl)-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-13-carbonitrile.
| Compound Name | (4R,4aR,7aR,12bS)-3-(cyclobutylmethyl)-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-13-carbonitrile |
|---|---|
| PubChem CID | 121267272 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (4R,4aR,7aR,12bS)-3-(cyclobutylmethyl)-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-13-carbonitrile |
| SMILES | N#CC1c2cccc3c2[C@]24CCN(CC5CCC5)[C@@H]1[C@@H]2CCC(=O)[C@@H]4O3 |
| InChI | InChI=1S/C22H24N2O2/c23-11-15-14-5-2-6-18-19(14)22-9-10-24(12-13-3-1-4-13)20(15)16(22)7-8-17(25)21(22)26-18/h2,5-6,13,15-16,20-21H,1,3-4,7-10,12H2/t15?,16-,20-,21-,22-/m0/s1 |
| InChIKey | YCRWYJSOMJXJHR-IKKUYXJHSA-N |
| XLogP | 3.16 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |