C26H33NO5 — CID 126538949
methyl (E)-3-[(7aS,12bR)-3-(cyclopropylmethyl)-9-methoxy-4,12-dimethyl-7-oxo-2,4,4a,5,6,7a-hexahydro-1H-[1]benzofuro[3,2-e]isoquinolin-11-yl]prop-2-enoate (PubChem CID 126538949) has the molecular formula C26H33NO5 and a molecular weight of 439.55 g/mol. Its IUPAC name is methyl (E)-3-[(7aS,12bR)-3-(cyclopropylmethyl)-9-methoxy-4,12-dimethyl-7-oxo-2,4,4a,5,6,7a-hexahydro-1H-[1]benzofuro[3,2-e]isoquinolin-11-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(7aS,12bR)-3-(cyclopropylmethyl)-9-methoxy-4,12-dimethyl-7-oxo-2,4,4a,5,6,7a-hexahydro-1H-[1]benzofuro[3,2-e]isoquinolin-11-yl]prop-2-enoate |
|---|---|
| PubChem CID | 126538949 |
| Molecular Formula | C26H33NO5 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | methyl (E)-3-[(7aS,12bR)-3-(cyclopropylmethyl)-9-methoxy-4,12-dimethyl-7-oxo-2,4,4a,5,6,7a-hexahydro-1H-[1]benzofuro[3,2-e]isoquinolin-11-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cc(OC)c2c(c1C)[C@@]13CCN(CC4CC4)C(C)C1CCC(=O)[C@H]3O2 |
| InChI | InChI=1S/C26H33NO5/c1-15-18(7-10-22(29)31-4)13-21(30-3)24-23(15)26-11-12-27(14-17-5-6-17)16(2)19(26)8-9-20(28)25(26)32-24/h7,10,13,16-17,19,25H,5-6,8-9,11-12,14H2,1-4H3/b10-7+/t16?,19?,25-,26-/m1/s1 |
| InChIKey | PGNZSHTVWUVDSV-PGRYFAFXSA-N |
| XLogP | 3.67 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|