C26H37NO5 — CID 134526055
methyl 3-[3-[(4aR)-2-(cyclopropylmethyl)-1-methyl-6-oxo-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-4a-yl]-4-hydroxy-5-methoxy-2-methylphenyl]propanoate (PubChem CID 134526055) has the molecular formula C26H37NO5 and a molecular weight of 443.58 g/mol. Its IUPAC name is methyl 3-[3-[(4aR)-2-(cyclopropylmethyl)-1-methyl-6-oxo-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-4a-yl]-4-hydroxy-5-methoxy-2-methylphenyl]propanoate.
| Compound Name | methyl 3-[3-[(4aR)-2-(cyclopropylmethyl)-1-methyl-6-oxo-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-4a-yl]-4-hydroxy-5-methoxy-2-methylphenyl]propanoate |
|---|---|
| PubChem CID | 134526055 |
| Molecular Formula | C26H37NO5 |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | methyl 3-[3-[(4aR)-2-(cyclopropylmethyl)-1-methyl-6-oxo-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-4a-yl]-4-hydroxy-5-methoxy-2-methylphenyl]propanoate |
| SMILES | COC(=O)CCc1cc(OC)c(O)c([C@@]23CCN(CC4CC4)C(C)C2CCC(=O)C3)c1C |
| InChI | InChI=1S/C26H37NO5/c1-16-19(7-10-23(29)32-4)13-22(31-3)25(30)24(16)26-11-12-27(15-18-5-6-18)17(2)21(26)9-8-20(28)14-26/h13,17-18,21,30H,5-12,14-15H2,1-4H3/t17?,21?,26-/m1/s1 |
| InChIKey | LZKBWOYSUSXUPU-NPCHLFKRSA-N |
| XLogP | 3.93 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |