C24H36N2O6 — CID 143836124
2-[[3-(1,2-dimethyl-6-oxo-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-4a-yl)-2-hydroxy-4-methylphenoxy]carbonylamino]acetic acid;propane (PubChem CID 143836124) has the molecular formula C24H36N2O6 and a molecular weight of 448.56 g/mol. Its IUPAC name is 2-[[3-(1,2-dimethyl-6-oxo-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-4a-yl)-2-hydroxy-4-methylphenoxy]carbonylamino]acetic acid;propane.
| Compound Name | 2-[[3-(1,2-dimethyl-6-oxo-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-4a-yl)-2-hydroxy-4-methylphenoxy]carbonylamino]acetic acid;propane |
|---|---|
| PubChem CID | 143836124 |
| Molecular Formula | C24H36N2O6 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | 2-[[3-(1,2-dimethyl-6-oxo-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-4a-yl)-2-hydroxy-4-methylphenoxy]carbonylamino]acetic acid;propane |
| SMILES | CCC.Cc1ccc(OC(=O)NCC(=O)O)c(O)c1C12CCN(C)C(C)C1CCC(=O)C2 |
| InChI | InChI=1S/C21H28N2O6.C3H8/c1-12-4-7-16(29-20(28)22-11-17(25)26)19(27)18(12)21-8-9-23(3)13(2)15(21)6-5-14(24)10-21;1-3-2/h4,7,13,15,27H,5-6,8-11H2,1-3H3,(H,22,28)(H,25,26);3H2,1-2H3 |
| InChIKey | AIAOSWZCGVHEIV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |