C20H31NO2 — CID 142209918
3-(1,2-dimethyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl)-4-ethyl-2-methoxyphenol (PubChem CID 142209918) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is 3-(1,2-dimethyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl)-4-ethyl-2-methoxyphenol.
| Compound Name | 3-(1,2-dimethyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl)-4-ethyl-2-methoxyphenol |
|---|---|
| PubChem CID | 142209918 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | 3-(1,2-dimethyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl)-4-ethyl-2-methoxyphenol |
| SMILES | CCc1ccc(O)c(OC)c1C12CCCCC1C(C)N(C)CC2 |
| InChI | InChI=1S/C20H31NO2/c1-5-15-9-10-17(22)19(23-4)18(15)20-11-7-6-8-16(20)14(2)21(3)13-12-20/h9-10,14,16,22H,5-8,11-13H2,1-4H3 |
| InChIKey | CMMHAHLVNAPAOG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |