C21H33NO3 — CID 162383818
4a-(6-ethyl-2-hydroxy-3-methoxyphenyl)-1,2,6-trimethyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-ol (PubChem CID 162383818) has the molecular formula C21H33NO3 and a molecular weight of 347.50 g/mol. Its IUPAC name is 4a-(6-ethyl-2-hydroxy-3-methoxyphenyl)-1,2,6-trimethyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-ol.
| Compound Name | 4a-(6-ethyl-2-hydroxy-3-methoxyphenyl)-1,2,6-trimethyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-ol |
|---|---|
| PubChem CID | 162383818 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | 4a-(6-ethyl-2-hydroxy-3-methoxyphenyl)-1,2,6-trimethyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-ol |
| SMILES | CCc1ccc(OC)c(O)c1C12CCN(C)C(C)C1(O)CCC(C)C2 |
| InChI | InChI=1S/C21H33NO3/c1-6-16-7-8-17(25-5)19(23)18(16)20-11-12-22(4)15(3)21(20,24)10-9-14(2)13-20/h7-8,14-15,23-24H,6,9-13H2,1-5H3 |
| InChIKey | DPPOPJHOAOWSRG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |