C21H29NO5 — CID 146363416
(1'R,9'R)-4'-methoxy-4,17'-dimethylspiro[1,3-dioxolane-2,13'-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene]-3',10'-diol (PubChem CID 146363416) has the molecular formula C21H29NO5 and a molecular weight of 375.47 g/mol. Its IUPAC name is (1'R,9'R)-4'-methoxy-4,17'-dimethylspiro[1,3-dioxolane-2,13'-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene]-3',10'-diol.
| Compound Name | (1'R,9'R)-4'-methoxy-4,17'-dimethylspiro[1,3-dioxolane-2,13'-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene]-3',10'-diol |
|---|---|
| PubChem CID | 146363416 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | (1'R,9'R)-4'-methoxy-4,17'-dimethylspiro[1,3-dioxolane-2,13'-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene]-3',10'-diol |
| SMILES | COc1ccc2c(c1O)[C@]13CCN(C)C(C2)C1(O)CCC1(C3)OCC(C)O1 |
| InChI | InChI=1S/C21H29NO5/c1-13-11-26-20(27-13)6-7-21(24)16-10-14-4-5-15(25-3)18(23)17(14)19(21,12-20)8-9-22(16)2/h4-5,13,16,23-24H,6-12H2,1-3H3/t13?,16?,19-,20?,21?/m1/s1 |
| InChIKey | YMSHUXUDLSTPHO-GLGRKRONSA-N |
| XLogP | 1.95 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |