C26H29NO6 — CID 46178471
[(1S,9S,10R)-3,13-dihydroxy-4,12-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-10-yl] benzoate (PubChem CID 46178471) has the molecular formula C26H29NO6 and a molecular weight of 451.52 g/mol. Its IUPAC name is [(1S,9S,10R)-3,13-dihydroxy-4,12-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-10-yl] benzoate.
| Compound Name | [(1S,9S,10R)-3,13-dihydroxy-4,12-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-10-yl] benzoate |
|---|---|
| PubChem CID | 46178471 |
| Molecular Formula | C26H29NO6 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | [(1S,9S,10R)-3,13-dihydroxy-4,12-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-10-yl] benzoate |
| SMILES | COC1=C[C@]2(OC(=O)c3ccccc3)[C@@H]3Cc4ccc(OC)c(O)c4[C@]2(CCN3C)CC1O |
| InChI | InChI=1S/C26H29NO6/c1-27-12-11-25-14-18(28)20(32-3)15-26(25,33-24(30)16-7-5-4-6-8-16)21(27)13-17-9-10-19(31-2)23(29)22(17)25/h4-10,15,18,21,28-29H,11-14H2,1-3H3/t18?,21-,25-,26-/m0/s1 |
| InChIKey | AZBXDITVJQZJLI-PEJSPTSTSA-N |
| XLogP | 2.79 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |