C20H25NO5 — CID 162939276
(1R,9S,10R)-4-hydroxy-3,11,12-trimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one (PubChem CID 162939276) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is (1R,9S,10R)-4-hydroxy-3,11,12-trimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one.
| Compound Name | (1R,9S,10R)-4-hydroxy-3,11,12-trimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one |
|---|---|
| PubChem CID | 162939276 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (1R,9S,10R)-4-hydroxy-3,11,12-trimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one |
| SMILES | COC1=C(OC)[C@H]2[C@@H]3Cc4ccc(O)c(OC)c4[C@]2(CCN3C)CC1=O |
| InChI | InChI=1S/C20H25NO5/c1-21-8-7-20-10-14(23)18(25-3)19(26-4)16(20)12(21)9-11-5-6-13(22)17(24-2)15(11)20/h5-6,12,16,22H,7-10H2,1-4H3/t12-,16+,20-/m0/s1 |
| InChIKey | OYKQTLWOKPWOOG-KRYHZZBUSA-N |
| XLogP | 1.99 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |