C21H27NO5 — CID 162996565
(1S,9R,10R)-4,5,12,13-tetramethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,12-tetraen-11-one (PubChem CID 162996565) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is (1S,9R,10R)-4,5,12,13-tetramethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,12-tetraen-11-one.
| Compound Name | (1S,9R,10R)-4,5,12,13-tetramethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,12-tetraen-11-one |
|---|---|
| PubChem CID | 162996565 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | (1S,9R,10R)-4,5,12,13-tetramethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,12-tetraen-11-one |
| SMILES | COC1=C(OC)C(=O)[C@H]2[C@H]3Cc4cc(OC)c(OC)cc4[C@@]2(CCN3C)C1 |
| InChI | InChI=1S/C21H27NO5/c1-22-7-6-21-11-17(26-4)20(27-5)19(23)18(21)14(22)8-12-9-15(24-2)16(25-3)10-13(12)21/h9-10,14,18H,6-8,11H2,1-5H3/t14-,18-,21-/m1/s1 |
| InChIKey | WDSOILMKWXUDGC-CFCCAZDESA-N |
| XLogP | 2.30 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |