C27H40N2O5 — CID 130178211
tert-butyl 3-[(4R,7S,7aR,12bS)-7-acetamido-9-hydroxy-3,4,12-trimethyl-1,2,4,4a,5,6,7,7a-octahydro-[1]benzofuro[3,2-e]isoquinolin-11-yl]propanoate (PubChem CID 130178211) has the molecular formula C27H40N2O5 and a molecular weight of 472.63 g/mol. Its IUPAC name is tert-butyl 3-[(4R,7S,7aR,12bS)-7-acetamido-9-hydroxy-3,4,12-trimethyl-1,2,4,4a,5,6,7,7a-octahydro-[1]benzofuro[3,2-e]isoquinolin-11-yl]propanoate.
| Compound Name | tert-butyl 3-[(4R,7S,7aR,12bS)-7-acetamido-9-hydroxy-3,4,12-trimethyl-1,2,4,4a,5,6,7,7a-octahydro-[1]benzofuro[3,2-e]isoquinolin-11-yl]propanoate |
|---|---|
| PubChem CID | 130178211 |
| Molecular Formula | C27H40N2O5 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | tert-butyl 3-[(4R,7S,7aR,12bS)-7-acetamido-9-hydroxy-3,4,12-trimethyl-1,2,4,4a,5,6,7,7a-octahydro-[1]benzofuro[3,2-e]isoquinolin-11-yl]propanoate |
| SMILES | CC(=O)N[C@H]1CCC2[C@@H](C)N(C)CC[C@@]23c2c(C)c(CCC(=O)OC(C)(C)C)cc(O)c2O[C@@H]13 |
| InChI | InChI=1S/C27H40N2O5/c1-15-18(8-11-22(32)34-26(4,5)6)14-21(31)24-23(15)27-12-13-29(7)16(2)19(27)9-10-20(25(27)33-24)28-17(3)30/h14,16,19-20,25,31H,8-13H2,1-7H3,(H,28,30)/t16-,19?,20+,25+,27+/m1/s1 |
| InChIKey | HVILWTAEJPZGIC-RQYDMJKTSA-N |
| XLogP | 3.61 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |