C27H38NO5P — CID 147851319
tert-butyl 3-[(4R,7R,7aR,12bS)-7-dimethylphosphoryl-9-hydroxy-3,7-dimethyl-1,2,4,4a,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]propanoate (PubChem CID 147851319) has the molecular formula C27H38NO5P and a molecular weight of 487.58 g/mol. Its IUPAC name is tert-butyl 3-[(4R,7R,7aR,12bS)-7-dimethylphosphoryl-9-hydroxy-3,7-dimethyl-1,2,4,4a,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]propanoate.
| Compound Name | tert-butyl 3-[(4R,7R,7aR,12bS)-7-dimethylphosphoryl-9-hydroxy-3,7-dimethyl-1,2,4,4a,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]propanoate |
|---|---|
| PubChem CID | 147851319 |
| Molecular Formula | C27H38NO5P |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | tert-butyl 3-[(4R,7R,7aR,12bS)-7-dimethylphosphoryl-9-hydroxy-3,7-dimethyl-1,2,4,4a,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]propanoate |
| SMILES | CN1CC[C@]23c4c5c(CCC(=O)OC(C)(C)C)cc(O)c4O[C@H]2[C@](C)(P(C)(C)=O)C=CC3[C@H]1C5 |
| InChI | InChI=1S/C27H38NO5P/c1-25(2,3)33-21(30)9-8-16-14-20(29)23-22-17(16)15-19-18-10-11-26(4,34(6,7)31)24(32-23)27(18,22)12-13-28(19)5/h10-11,14,18-19,24,29H,8-9,12-13,15H2,1-7H3/t18?,19-,24+,26-,27+/m1/s1 |
| InChIKey | HUWLDFAIYSQZNQ-CEXWIZQOSA-N |
| XLogP | 4.49 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|