C28H48NO5PS — CID 144720611
tert-butyl 3-[3-(1,2-dimethyl-1,3,4,5,6,8a-hexahydroisoquinolin-4a-yl)-4,5-dihydroxy-2-methylphenyl]propanoate;dimethylphosphinous acid;methanethiol (PubChem CID 144720611) has the molecular formula C28H48NO5PS and a molecular weight of 541.74 g/mol. Its IUPAC name is tert-butyl 3-[3-(1,2-dimethyl-1,3,4,5,6,8a-hexahydroisoquinolin-4a-yl)-4,5-dihydroxy-2-methylphenyl]propanoate;dimethylphosphinous acid;methanethiol.
| Compound Name | tert-butyl 3-[3-(1,2-dimethyl-1,3,4,5,6,8a-hexahydroisoquinolin-4a-yl)-4,5-dihydroxy-2-methylphenyl]propanoate;dimethylphosphinous acid;methanethiol |
|---|---|
| PubChem CID | 144720611 |
| Molecular Formula | C28H48NO5PS |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.30 |
| IUPAC Name | tert-butyl 3-[3-(1,2-dimethyl-1,3,4,5,6,8a-hexahydroisoquinolin-4a-yl)-4,5-dihydroxy-2-methylphenyl]propanoate;dimethylphosphinous acid;methanethiol |
| SMILES | CP(C)O.CS.Cc1c(CCC(=O)OC(C)(C)C)cc(O)c(O)c1C12CCC=CC1C(C)N(C)CC2 |
| InChI | InChI=1S/C25H37NO4.C2H7OP.CH4S/c1-16-18(10-11-21(28)30-24(3,4)5)15-20(27)23(29)22(16)25-12-8-7-9-19(25)17(2)26(6)14-13-25;1-4(2)3;1-2/h7,9,15,17,19,27,29H,8,10-14H2,1-6H3;3H,1-2H3;2H,1H3 |
| InChIKey | IQAFJMWKRLQWGY-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|