C14H19F3N4O4 — CID 121267777
ethyl 2-[2-[2-methoxyethyl(methyl)carbamoyl]hydrazinyl]-6-(trifluoromethyl)pyridine-3-carboxylate (PubChem CID 121267777) has the molecular formula C14H19F3N4O4 and a molecular weight of 364.32 g/mol. Its IUPAC name is ethyl 2-[2-[2-methoxyethyl(methyl)carbamoyl]hydrazinyl]-6-(trifluoromethyl)pyridine-3-carboxylate.
| Compound Name | ethyl 2-[2-[2-methoxyethyl(methyl)carbamoyl]hydrazinyl]-6-(trifluoromethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 121267777 |
| Molecular Formula | C14H19F3N4O4 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | ethyl 2-[2-[2-methoxyethyl(methyl)carbamoyl]hydrazinyl]-6-(trifluoromethyl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(C(F)(F)F)nc1NNC(=O)N(C)CCOC |
| InChI | InChI=1S/C14H19F3N4O4/c1-4-25-12(22)9-5-6-10(14(15,16)17)18-11(9)19-20-13(23)21(2)7-8-24-3/h5-6H,4,7-8H2,1-3H3,(H,18,19)(H,20,23) |
| InChIKey | UKQPDOUJDXDGHT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|