C14H22N2O5S — CID 121268660
[5-tert-butyl-3-(ethylsulfonylamino)-2-methoxyphenyl]carbamic acid (PubChem CID 121268660) has the molecular formula C14H22N2O5S and a molecular weight of 330.41 g/mol. Its IUPAC name is [5-tert-butyl-3-(ethylsulfonylamino)-2-methoxyphenyl]carbamic acid.
| Compound Name | [5-tert-butyl-3-(ethylsulfonylamino)-2-methoxyphenyl]carbamic acid |
|---|---|
| PubChem CID | 121268660 |
| Molecular Formula | C14H22N2O5S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | [5-tert-butyl-3-(ethylsulfonylamino)-2-methoxyphenyl]carbamic acid |
| SMILES | CCS(=O)(=O)Nc1cc(C(C)(C)C)cc(NC(=O)O)c1OC |
| InChI | InChI=1S/C14H22N2O5S/c1-6-22(19,20)16-11-8-9(14(2,3)4)7-10(12(11)21-5)15-13(17)18/h7-8,15-16H,6H2,1-5H3,(H,17,18) |
| InChIKey | SFHQGRYSSABQDS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |