C8H12ClF3 — CID 121273903
2-chloro-1,1-dimethyl-3-(1,1,1-trifluoropropan-2-yl)cyclopropane (PubChem CID 121273903) has the molecular formula C8H12ClF3 and a molecular weight of 200.63 g/mol. Its IUPAC name is 2-chloro-1,1-dimethyl-3-(1,1,1-trifluoropropan-2-yl)cyclopropane.
| Compound Name | 2-chloro-1,1-dimethyl-3-(1,1,1-trifluoropropan-2-yl)cyclopropane |
|---|---|
| PubChem CID | 121273903 |
| Molecular Formula | C8H12ClF3 |
| Molecular Weight | 200.63 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 2-chloro-1,1-dimethyl-3-(1,1,1-trifluoropropan-2-yl)cyclopropane |
| SMILES | CC(C1C(Cl)C1(C)C)C(F)(F)F |
| InChI | InChI=1S/C8H12ClF3/c1-4(8(10,11)12)5-6(9)7(5,2)3/h4-6H,1-3H3 |
| InChIKey | NNVCYIPHEXBIGY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.63 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|