C22H26N4O3S — CID 121274354
N-methyl-5-(4-methylphenyl)-15-methylsulfonyl-3,4,15-triazatricyclo[7.6.0.03,7]pentadeca-1,4,6,8-tetraene-6-carboxamide (PubChem CID 121274354) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is N-methyl-5-(4-methylphenyl)-15-methylsulfonyl-3,4,15-triazatricyclo[7.6.0.03,7]pentadeca-1,4,6,8-tetraene-6-carboxamide.
| Compound Name | N-methyl-5-(4-methylphenyl)-15-methylsulfonyl-3,4,15-triazatricyclo[7.6.0.03,7]pentadeca-1,4,6,8-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 121274354 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N-methyl-5-(4-methylphenyl)-15-methylsulfonyl-3,4,15-triazatricyclo[7.6.0.03,7]pentadeca-1,4,6,8-tetraene-6-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(C)cc2)nn2cc3c(cc12)CCCCCN3S(C)(=O)=O |
| InChI | InChI=1S/C22H26N4O3S/c1-15-8-10-16(11-9-15)21-20(22(27)23-2)18-13-17-7-5-4-6-12-26(30(3,28)29)19(17)14-25(18)24-21/h8-11,13-14H,4-7,12H2,1-3H3,(H,23,27) |
| InChIKey | ZQHYAJFZZOBJPK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |