C17H38N2O2S — CID 121274624
N-[5-[[di(propan-2-yl)amino]methyl]-3-methylheptan-3-yl]-N-methylmethanesulfonamide (PubChem CID 121274624) has the molecular formula C17H38N2O2S and a molecular weight of 334.57 g/mol. Its IUPAC name is N-[5-[[di(propan-2-yl)amino]methyl]-3-methylheptan-3-yl]-N-methylmethanesulfonamide.
| Compound Name | N-[5-[[di(propan-2-yl)amino]methyl]-3-methylheptan-3-yl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 121274624 |
| Molecular Formula | C17H38N2O2S |
| Molecular Weight | 334.57 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | N-[5-[[di(propan-2-yl)amino]methyl]-3-methylheptan-3-yl]-N-methylmethanesulfonamide |
| SMILES | CCC(CN(C(C)C)C(C)C)CC(C)(CC)N(C)S(C)(=O)=O |
| InChI | InChI=1S/C17H38N2O2S/c1-10-16(13-19(14(3)4)15(5)6)12-17(7,11-2)18(8)22(9,20)21/h14-16H,10-13H2,1-9H3 |
| InChIKey | HJHONWOUOKEWKM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.57 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |