C17H35N3O2 — CID 121280766
1-[[(4S,7R,8aS)-7-methoxy-4-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-6-yl]amino]-4-(dimethylamino)butan-1-ol (PubChem CID 121280766) has the molecular formula C17H35N3O2 and a molecular weight of 313.49 g/mol. Its IUPAC name is 1-[[(4S,7R,8aS)-7-methoxy-4-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-6-yl]amino]-4-(dimethylamino)butan-1-ol.
| Compound Name | 1-[[(4S,7R,8aS)-7-methoxy-4-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-6-yl]amino]-4-(dimethylamino)butan-1-ol |
|---|---|
| PubChem CID | 121280766 |
| Molecular Formula | C17H35N3O2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.27 |
| IUPAC Name | 1-[[(4S,7R,8aS)-7-methoxy-4-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-6-yl]amino]-4-(dimethylamino)butan-1-ol |
| SMILES | CO[C@@H]1C[C@@H]2NCC[C@H](C)C2CC1NC(O)CCCN(C)C |
| InChI | InChI=1S/C17H35N3O2/c1-12-7-8-18-14-11-16(22-4)15(10-13(12)14)19-17(21)6-5-9-20(2)3/h12-19,21H,5-11H2,1-4H3/t12-,13?,14-,15?,16+,17?/m0/s1 |
| InChIKey | MUITVLYYCNAXKO-OASIBSDESA-N |
| XLogP | 1.03 |
| TPSA | 56.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|