C13H23NO3 — CID 163940390
5-methoxy-10-methyl-2,3,4a,5,6,6a,7,8,9,10,10a,10b-dodecahydro-[1,4]dioxino[2,3-f]quinoline (PubChem CID 163940390) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is 5-methoxy-10-methyl-2,3,4a,5,6,6a,7,8,9,10,10a,10b-dodecahydro-[1,4]dioxino[2,3-f]quinoline.
| Compound Name | 5-methoxy-10-methyl-2,3,4a,5,6,6a,7,8,9,10,10a,10b-dodecahydro-[1,4]dioxino[2,3-f]quinoline |
|---|---|
| PubChem CID | 163940390 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 5-methoxy-10-methyl-2,3,4a,5,6,6a,7,8,9,10,10a,10b-dodecahydro-[1,4]dioxino[2,3-f]quinoline |
| SMILES | COC1CC2NCCC(C)C2C2OCCOC12 |
| InChI | InChI=1S/C13H23NO3/c1-8-3-4-14-9-7-10(15-2)12-13(11(8)9)17-6-5-16-12/h8-14H,3-7H2,1-2H3 |
| InChIKey | RQMJTMZESIMKAN-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |