C8H12O3 — CID 163552350
8-methoxy-2,5-dioxatricyclo[4.3.0.07,9]nonane (PubChem CID 163552350) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is 8-methoxy-2,5-dioxatricyclo[4.3.0.07,9]nonane.
| Compound Name | 8-methoxy-2,5-dioxatricyclo[4.3.0.07,9]nonane |
|---|---|
| PubChem CID | 163552350 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 8-methoxy-2,5-dioxatricyclo[4.3.0.07,9]nonane |
| SMILES | COC1C2C3OCCOC3C12 |
| InChI | InChI=1S/C8H12O3/c1-9-6-4-5(6)8-7(4)10-2-3-11-8/h4-8H,2-3H2,1H3 |
| InChIKey | FKCWDVUCBMFLCH-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |