C10H18O5 — CID 140529080
4,5,7-trimethoxy-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole (PubChem CID 140529080) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is 4,5,7-trimethoxy-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole.
| Compound Name | 4,5,7-trimethoxy-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole |
|---|---|
| PubChem CID | 140529080 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 4,5,7-trimethoxy-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole |
| SMILES | COC1CC(OC)C2OCOC2C1OC |
| InChI | InChI=1S/C10H18O5/c1-11-6-4-7(12-2)9-10(8(6)13-3)15-5-14-9/h6-10H,4-5H2,1-3H3 |
| InChIKey | IBFBRNQJOKSNHG-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |